CAS 132034-91-4 appears in our catalog under these names: 4 6–DIETHYLDIBENZOTHIOPHENE, 4,6-Diethyldibenzothiophene. Offered by: GLPBio, Chemat. Available pack sizes: 1g.
4,6-diethyldibenzothiophene (CAS 132034-91-4) is a chemical compound with the molecular formula C16H16S and a molecular weight of 240.4 g/mol. IUPAC name: 4,6-diethyldibenzothiophene. InChIKey: UMQGGSYHJPHWFV-UHFFFAOYSA-N.
| Molecular formula | C16H16S |
|---|---|
| Molecular weight | 240.4 g/mol |
| IUPAC name | 4,6-diethyldibenzothiophene |
| InChIKey | UMQGGSYHJPHWFV-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C3=CC=CC(=C3S2)CC |
Computed by PubChem (NCBI)