CAS 132036-42-1 is the registry number for Ramosetron Impurity 12 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
Pyrrolidin-1-yl(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone;hydrochloride (CAS 132036-42-1) is a chemical compound with the molecular formula C12H18ClN3O and a molecular weight of 255.74 g/mol. IUPAC name: pyrrolidin-1-yl(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone;hydrochloride. InChIKey: VIQQUDRWPRGFBZ-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3O |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | pyrrolidin-1-yl(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone;hydrochloride |
| InChIKey | VIQQUDRWPRGFBZ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2CCC3=C(C2)NC=N3.Cl |
Computed by PubChem (NCBI)