CAS 13205-46-4 appears in our catalog under these names: 4–Isopropoxybenzoic Acid, 4-Isopropoxybenzoic acid, 99% , 4-Isopropoxybenzoic acid 98%, 4-Isopropoxybenzoic acid, 99.95%, 4-Isopropoxybenzoic acid, ≥98%, ≥98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, MedChemExpress, Chemat. Available pack sizes: 10g, 250g, 25g, 50g, 5g, 100g, 100 mg, 250 mg.
4-propan-2-yloxybenzoic acid (CAS 13205-46-4) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 4-propan-2-yloxybenzoic acid. InChIKey: ZVERWTXKKWSSHH-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 4-propan-2-yloxybenzoic acid |
| InChIKey | ZVERWTXKKWSSHH-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)