CAS 13207-63-1 appears in our catalog under these names: Iodoquinol Impurity 5, 5-Iodoquinolin-8-ol, 95+%. Offered by: Hubei YoungXin, AmBeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
5-iodoquinolin-8-ol (CAS 13207-63-1) is a chemical compound with the molecular formula C9H6INO and a molecular weight of 271.05 g/mol. IUPAC name: 5-iodoquinolin-8-ol. InChIKey: SUQZNPQQZDQDPJ-UHFFFAOYSA-N.
| Molecular formula | C9H6INO |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 5-iodoquinolin-8-ol |
| InChIKey | SUQZNPQQZDQDPJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)I |
Computed by PubChem (NCBI)