CAS 13209-16-0 appears in our catalog under these names: 4-Nitro-alpha,alpha,alpha',alpha'-tetrabromo-o-xylene, 95%, 1,2-Bis(dibromomethyl)-4-nitrobenzene, 95%, 4–Nitro–α,α,α',α'–tetrabromo–o–xylene, 4-Nitro-alpha,alpha,alpha',alpha'-tetrabromo-o-xylene, >95.0%(GC), 1,2-Bis(dibromomethyl)-4-nitrobenzene, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g.
1,2-bis(dibromomethyl)-4-nitrobenzene (CAS 13209-16-0) is a chemical compound with the molecular formula C8H5Br4NO2 and a molecular weight of 466.75 g/mol. IUPAC name: 1,2-bis(dibromomethyl)-4-nitrobenzene. InChIKey: KYHYXMVGEXICQQ-UHFFFAOYSA-N.
| Molecular formula | C8H5Br4NO2 |
|---|---|
| Molecular weight | 466.75 g/mol |
| IUPAC name | 1,2-bis(dibromomethyl)-4-nitrobenzene |
| InChIKey | KYHYXMVGEXICQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(Br)Br)C(Br)Br |
Computed by PubChem (NCBI)