CAS 13209-20-6 appears in our catalog under these names: Alpha,alpha,alpha',alpha',4,5-hexabromo-o-xylene, 95%, alpha,alpha,alpha',alpha',4,5-Hexabromo-o-xylene, >98.0%(GC), 1,2-Dibromo-4,5-bis(dibromomethyl)benzene 98%, ALPHA,ALPHA,ALPHA',ALPHA',4,5-HEXABROMO-O-XYLENE, 98%+(GC-MS),RG. Offered by: Combi-blocks, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1,2-dibromo-4,5-bis(dibromomethyl)benzene (CAS 13209-20-6) is a chemical compound with the molecular formula C8H4Br6 and a molecular weight of 579.5 g/mol. IUPAC name: 1,2-dibromo-4,5-bis(dibromomethyl)benzene. InChIKey: QPLVNMIEWOGDBY-UHFFFAOYSA-N.
| Molecular formula | C8H4Br6 |
|---|---|
| Molecular weight | 579.5 g/mol |
| IUPAC name | 1,2-dibromo-4,5-bis(dibromomethyl)benzene |
| InChIKey | QPLVNMIEWOGDBY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)C(Br)Br)C(Br)Br |
Computed by PubChem (NCBI)