CAS 132090-51-8 appears in our catalog under these names: 2,2'-Thiodiacetic-2,2,2',2'-d4 Acid, 99 atom % D, min 98% Chemical Purity, Thiodiglycolic Acid-d4, >95% (HPLC), Thiodiglycolic Acid–d4, 2,2'-Thiodiacetic acid-d4. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1mg, 5mg, 500μg, 500 μg.
2-[carboxy(dideuterio)methyl]sulfanyl-2,2-dideuterioacetic acid (CAS 132090-51-8) is a chemical compound with the molecular formula C4H6O4S and a molecular weight of 154.18 g/mol. IUPAC name: 2-[carboxy(dideuterio)methyl]sulfanyl-2,2-dideuterioacetic acid. InChIKey: UVZICZIVKIMRNE-LNLMKGTHSA-N.
| Molecular formula | C4H6O4S |
|---|---|
| Molecular weight | 154.18 g/mol |
| IUPAC name | 2-[carboxy(dideuterio)methyl]sulfanyl-2,2-dideuterioacetic acid |
| InChIKey | UVZICZIVKIMRNE-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C(=O)O)SC([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)