CAS 132097-01-9 is the registry number for N-(9-(Diethylamino)-5H-benzo[a]phenoxazin-5-ylidene)-2-naphthamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[9-(diethylamino)benzo[a]phenoxazin-5-ylidene]naphthalene-2-carboxamide (CAS 132097-01-9) is a chemical compound with the molecular formula C31H25N3O2 and a molecular weight of 471.5 g/mol. IUPAC name: N-[9-(diethylamino)benzo[a]phenoxazin-5-ylidene]naphthalene-2-carboxamide. InChIKey: KISNZWYZDRRYKE-UHFFFAOYSA-N.
| Molecular formula | C31H25N3O2 |
|---|---|
| Molecular weight | 471.5 g/mol |
| IUPAC name | N-[9-(diethylamino)benzo[a]phenoxazin-5-ylidene]naphthalene-2-carboxamide |
| InChIKey | KISNZWYZDRRYKE-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=NC(=O)C5=CC6=CC=CC=C6C=C5)C=C3O2 |
Computed by PubChem (NCBI)