CAS 132125-39-4 appears in our catalog under these names: 4,4'-Dipyridyl-d8, >95% (HPLC), 4,4'-Dipyridyl-d8, 98 atom % D, min 98% Chemical Purity, 4,4'-DIPYRIDYL-D8 98%, 4,4′-Dipyridyl-d8. Offered by: TRC, CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25mg, 5mg, 0,5g, 0,25g, 1G, 25 mg, 5 mg.
2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-pyridinyl)pyridine (CAS 132125-39-4) is a chemical compound with the molecular formula C10H8N2 and a molecular weight of 164.23 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-pyridinyl)pyridine. InChIKey: MWVTWFVJZLCBMC-PGRXLJNUSA-N.
| Molecular formula | C10H8N2 |
|---|---|
| Molecular weight | 164.23 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-pyridinyl)pyridine |
| InChIKey | MWVTWFVJZLCBMC-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(N=C(C(=C1C2=C(C(=NC(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)