CAS 1321514-06-0 appears in our catalog under these names: AZD4635/ 99.61% (existing batch purity), AZD4635, Imaradenant 97%, 6-(2-chloro-6-methyl-4-pyridinyl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine, 97%, 97%, Imaradenant, 99.68%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
6-(2-chloro-6-methyl-4-pyridinyl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine (CAS 1321514-06-0) is a chemical compound with the molecular formula C15H11ClFN5 and a molecular weight of 315.73 g/mol. IUPAC name: 6-(2-chloro-6-methyl-4-pyridinyl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine. InChIKey: NCWQLHHDGDXIJN-UHFFFAOYSA-N.
| Molecular formula | C15H11ClFN5 |
|---|---|
| Molecular weight | 315.73 g/mol |
| IUPAC name | 6-(2-chloro-6-methyl-4-pyridinyl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine |
| InChIKey | NCWQLHHDGDXIJN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)Cl)C2=C(N=C(N=N2)N)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)