CAS 132203-26-0 appears in our catalog under these names: (S)-3-Hydroxy-3-phenylpropanenitrile, 95.0%, (3S)-3-Hydroxy-3-phenylpropanenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 1000mg, 500mg.
(3S)-3-hydroxy-3-phenylpropanenitrile (CAS 132203-26-0) is a chemical compound with the molecular formula C9H9NO and a molecular weight of 147.17 g/mol. IUPAC name: (3S)-3-hydroxy-3-phenylpropanenitrile. InChIKey: HILDHWAXSORHRZ-VIFPVBQESA-N.
| Molecular formula | C9H9NO |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (3S)-3-hydroxy-3-phenylpropanenitrile |
| InChIKey | HILDHWAXSORHRZ-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CC#N)O |
Computed by PubChem (NCBI)