CAS 1322081-46-8 is the registry number for 2-(1-(4-(2-Naphthamido)benzyl)-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3,5-dimethyl-1-[[4-(naphthalene-2-carbonylamino)phenyl]methyl]pyrazol-4-yl]acetic acid (CAS 1322081-46-8) is a chemical compound with the molecular formula C25H23N3O3 and a molecular weight of 413.5 g/mol. IUPAC name: 2-[3,5-dimethyl-1-[[4-(naphthalene-2-carbonylamino)phenyl]methyl]pyrazol-4-yl]acetic acid. InChIKey: CETXWOBUNLBPNB-UHFFFAOYSA-N.
| Molecular formula | C25H23N3O3 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | 2-[3,5-dimethyl-1-[[4-(naphthalene-2-carbonylamino)phenyl]methyl]pyrazol-4-yl]acetic acid |
| InChIKey | CETXWOBUNLBPNB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(C=C2)NC(=O)C3=CC4=CC=CC=C4C=C3)C)CC(=O)O |
Computed by PubChem (NCBI)