CAS 1322091-22-4 is the registry number for 4–Fluoro–2–(p–tolylethynyl)benzaldehyde. Offered by: GLPBio. Available pack sizes: 1g.
4-fluoro-2-[2-(4-methylphenyl)ethynyl]benzaldehyde (CAS 1322091-22-4) is a chemical compound with the molecular formula C16H11FO and a molecular weight of 238.26 g/mol. IUPAC name: 4-fluoro-2-[2-(4-methylphenyl)ethynyl]benzaldehyde. InChIKey: BDEXWXCUOIRBJP-UHFFFAOYSA-N.
| Molecular formula | C16H11FO |
|---|---|
| Molecular weight | 238.26 g/mol |
| IUPAC name | 4-fluoro-2-[2-(4-methylphenyl)ethynyl]benzaldehyde |
| InChIKey | BDEXWXCUOIRBJP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C#CC2=C(C=CC(=C2)F)C=O |
Computed by PubChem (NCBI)