CAS 132215-92-0 is the registry number for rel–(2R,3R)–2–Hydroxy–N,N,N–trimethylethanaminium 2,3–dihydroxybutanedioate. Offered by: GLPBio. Available pack sizes: 5g.
2-hydroxyethyl(trimethyl)azanium;(2S,3S)-2,3,4-trihydroxy-4-oxobutanoate (CAS 132215-92-0) is a chemical compound with the molecular formula C9H19NO7 and a molecular weight of 253.25 g/mol. IUPAC name: 2-hydroxyethyl(trimethyl)azanium;(2S,3S)-2,3,4-trihydroxy-4-oxobutanoate. InChIKey: QWJSAWXRUVVRLH-WUUYCOTASA-M.
| Molecular formula | C9H19NO7 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 2-hydroxyethyl(trimethyl)azanium;(2S,3S)-2,3,4-trihydroxy-4-oxobutanoate |
| InChIKey | QWJSAWXRUVVRLH-WUUYCOTASA-M |
| SMILES | C[N+](C)(C)CCO.[C@H]([C@@H](C(=O)[O-])O)(C(=O)O)O |
Computed by PubChem (NCBI)