CAS 1322625-10-4 is the registry number for Florfenicol Chloro Analogue. Offered by: TRC. Available pack sizes: 25mg.
2,2-dichloro-N-[(1R)-3-chloro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide (CAS 1322625-10-4) is a chemical compound with the molecular formula C12H14Cl3NO4S and a molecular weight of 374.7 g/mol. IUPAC name: 2,2-dichloro-N-[(1R)-3-chloro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide. InChIKey: JDISIWJQLYRKTJ-QVDQXJPCSA-N.
| Molecular formula | C12H14Cl3NO4S |
|---|---|
| Molecular weight | 374.7 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1R)-3-chloro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChIKey | JDISIWJQLYRKTJ-QVDQXJPCSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H](C(CCl)NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)