CAS 1322626-20-9 is the registry number for N-Benzoyl Florfenicol Amine. Offered by: TRC. Available pack sizes: 25mg.
N-[(1R)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]benzamide (CAS 1322626-20-9) is a chemical compound with the molecular formula C17H18FNO4S and a molecular weight of 351.4 g/mol. IUPAC name: N-[(1R)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]benzamide. InChIKey: MUYIXUSIKJZXBP-OEMAIJDKSA-N.
| Molecular formula | C17H18FNO4S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | N-[(1R)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]benzamide |
| InChIKey | MUYIXUSIKJZXBP-OEMAIJDKSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H](C(CF)NC(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)