CAS 1322626-69-6 is the registry number for trans-(2-(4-tert-Butyloxycarbonylamino)cyclohexyloxy)tetrahydro-2H-pyran-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Tert-butyl N-[3,3,4,5,5-pentadeuterio-4-(oxan-2-yloxy)cyclohexyl]carbamate (CAS 1322626-69-6) is a chemical compound with the molecular formula C16H29NO4 and a molecular weight of 304.44 g/mol. IUPAC name: tert-butyl N-[3,3,4,5,5-pentadeuterio-4-(oxan-2-yloxy)cyclohexyl]carbamate. InChIKey: HZWRRGNCVVZGPJ-UXCJJYBCSA-N.
| Molecular formula | C16H29NO4 |
|---|---|
| Molecular weight | 304.44 g/mol |
| IUPAC name | tert-butyl N-[3,3,4,5,5-pentadeuterio-4-(oxan-2-yloxy)cyclohexyl]carbamate |
| InChIKey | HZWRRGNCVVZGPJ-UXCJJYBCSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])OC2CCCCO2)([2H])[2H])NC(=O)OC(C)(C)C)[2H] |
Computed by PubChem (NCBI)