CAS 1322681-37-7 appears in our catalog under these names: Mycophenolate Mofetil EP Impurity D, O-Methyl Mycophenolate Mofetil (EP Impurity D), >95% (HPLC), MYCOPHENOLATE O-METHYL ANALOG, Mycophenolate impurity 3. Offered by: Chemat Brand, TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 25MG, Get quote.
2-morpholin-4-ylethyl (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (CAS 1322681-37-7) is a chemical compound with the molecular formula C24H33NO7 and a molecular weight of 447.5 g/mol. IUPAC name: 2-morpholin-4-ylethyl (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate. InChIKey: KOEZVGVALFAIMS-FZSIALSZSA-N.
| Molecular formula | C24H33NO7 |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | 2-morpholin-4-ylethyl (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| InChIKey | KOEZVGVALFAIMS-FZSIALSZSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)OCCN3CCOCC3)OC |
Computed by PubChem (NCBI)