Products 132298-11-4
CAS 132298-11-4 is the registry number for 1-Propanone, 1-(4-aminophenyl)-2-chloro-, (R)- (9CI), >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-1-(4-aminophenyl)-2-chloropropan-1-one (CAS 132298-11-4) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: (2R)-1-(4-aminophenyl)-2-chloropropan-1-one. InChIKey: ZKFSGOCBENBOEA-ZCFIWIBFSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (2R)-1-(4-aminophenyl)-2-chloropropan-1-one |
| InChIKey | ZKFSGOCBENBOEA-ZCFIWIBFSA-N |
| SMILES | C[C@H](C(=O)C1=CC=C(C=C1)N)Cl |
Computed by PubChem (NCBI)