CAS 13230-03-0 appears in our catalog under these names: 2-ethyl-5-nitro-1H-imidazole, 2-Ethyl-4-nitro-1H-imidazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
2-ethyl-5-nitro-1H-imidazole (CAS 13230-03-0) is a chemical compound with the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. IUPAC name: 2-ethyl-5-nitro-1H-imidazole. InChIKey: MXNAZXOOFZKJEV-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O2 |
|---|---|
| Molecular weight | 141.13 g/mol |
| IUPAC name | 2-ethyl-5-nitro-1H-imidazole |
| InChIKey | MXNAZXOOFZKJEV-UHFFFAOYSA-N |
| SMILES | CCC1=NC=C(N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)