CAS 13230-04-1 appears in our catalog under these names: 1,2-Dimethyl-4-nitro-1h-imidazole, 95%, 1,2-Dimethyl-4-nitro-1H-imidazole, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1,2-dimethyl-4-nitroimidazole (CAS 13230-04-1) is a chemical compound with the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. IUPAC name: 1,2-dimethyl-4-nitroimidazole. InChIKey: YJJBSMOKINSQQF-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O2 |
|---|---|
| Molecular weight | 141.13 g/mol |
| IUPAC name | 1,2-dimethyl-4-nitroimidazole |
| InChIKey | YJJBSMOKINSQQF-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1C)[N+](=O)[O-] |
Computed by PubChem (NCBI)