CAS 132301-89-4 appears in our catalog under these names: Cloperastine Impurity 1((S)-Cloperastine) (Levocloperastine), (S)-Cloperastine (Levocloperastine), (S)-Cloperastine. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
1-[2-[(S)-(4-chlorophenyl)-phenylmethoxy]ethyl]piperidine (CAS 132301-89-4) is a chemical compound with the molecular formula C20H24ClNO and a molecular weight of 329.9 g/mol. IUPAC name: 1-[2-[(S)-(4-chlorophenyl)-phenylmethoxy]ethyl]piperidine. InChIKey: FLNXBVJLPJNOSI-FQEVSTJZSA-N.
| Molecular formula | C20H24ClNO |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | 1-[2-[(S)-(4-chlorophenyl)-phenylmethoxy]ethyl]piperidine |
| InChIKey | FLNXBVJLPJNOSI-FQEVSTJZSA-N |
| SMILES | C1CCN(CC1)CCO[C@@H](C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)