CAS 132316-46-2 appears in our catalog under these names: N–(2–(2–(2–(2–Aminoethoxy)ethoxy)ethoxy)ethyl)–2,4–dinitroaniline, DNP-PEG3-NH2. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, Get quote.
N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2,4-dinitroaniline (CAS 132316-46-2) is a chemical compound with the molecular formula C14H22N4O7 and a molecular weight of 358.35 g/mol. IUPAC name: N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2,4-dinitroaniline. InChIKey: RSSLKEPQOZRVQA-UHFFFAOYSA-N.
| Molecular formula | C14H22N4O7 |
|---|---|
| Molecular weight | 358.35 g/mol |
| IUPAC name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2,4-dinitroaniline |
| InChIKey | RSSLKEPQOZRVQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCOCCOCCOCCN |
Computed by PubChem (NCBI)