CAS 13232-65-0 appears in our catalog under these names: 5,6-Dibromo-3',6'-dihydroxy-3H-spiro(2-benzofuran-1,9'-xanthene)-3-one, 95%, 5,6–Dibromo–3',6'–dihydroxy–3h–spiro(isobenzofuran–1,9'–xanthen)–3–one. Offered by: AmBeed, GLPBio. Available pack sizes: 1mg, 100mg, 10g, 1g, 2,5g, 250mg, 50mg, 500mg.
5,6-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 13232-65-0) is a chemical compound with the molecular formula C20H10Br2O5 and a molecular weight of 490.1 g/mol. IUPAC name: 5,6-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: VOKQJLATDGDTGW-UHFFFAOYSA-N.
| Molecular formula | C20H10Br2O5 |
|---|---|
| Molecular weight | 490.1 g/mol |
| IUPAC name | 5,6-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | VOKQJLATDGDTGW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC3=C(C24C5=CC(=C(C=C5C(=O)O4)Br)Br)C=CC(=C3)O |
Computed by PubChem (NCBI)