CAS 132331-08-9 is the registry number for 3-Amino-2,4,6-tribromophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-amino-2,4,6-tribromophenol (CAS 132331-08-9) is a chemical compound with the molecular formula C6H4Br3NO and a molecular weight of 345.81 g/mol. IUPAC name: 3-amino-2,4,6-tribromophenol. InChIKey: SJWCHTASGVKLLS-UHFFFAOYSA-N.
| Molecular formula | C6H4Br3NO |
|---|---|
| Molecular weight | 345.81 g/mol |
| IUPAC name | 3-amino-2,4,6-tribromophenol |
| InChIKey | SJWCHTASGVKLLS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)Br)N)Br |
Computed by PubChem (NCBI)