Products 132331-92-1
CAS 132331-92-1 appears in our catalog under these names: Maltol-d3, >95% (HPLC), Maltol-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
3-hydroxy-2-(trideuteriomethyl)pyran-4-one (CAS 132331-92-1) is a chemical compound with the molecular formula C6H6O3 and a molecular weight of 129.13 g/mol. IUPAC name: 3-hydroxy-2-(trideuteriomethyl)pyran-4-one. InChIKey: XPCTZQVDEJYUGT-FIBGUPNXSA-N.
| Molecular formula | C6H6O3 |
|---|---|
| Molecular weight | 129.13 g/mol |
| IUPAC name | 3-hydroxy-2-(trideuteriomethyl)pyran-4-one |
| InChIKey | XPCTZQVDEJYUGT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=O)C=CO1)O |
Computed by PubChem (NCBI)