Products 132331-94-3
CAS 132331-94-3 is the registry number for 1-(2-Furyl)ethanol-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 5mg, 10 mg, 2.5 mg, 5 mg.
2,2,2-trideuterio-1-(furan-2-yl)ethanol (CAS 132331-94-3) is a chemical compound with the molecular formula C6H8O2 and a molecular weight of 115.14 g/mol. IUPAC name: 2,2,2-trideuterio-1-(furan-2-yl)ethanol. InChIKey: UABXUIWIFUZYQK-FIBGUPNXSA-N.
| Molecular formula | C6H8O2 |
|---|---|
| Molecular weight | 115.14 g/mol |
| IUPAC name | 2,2,2-trideuterio-1-(furan-2-yl)ethanol |
| InChIKey | UABXUIWIFUZYQK-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=CO1)O |
Computed by PubChem (NCBI)