CAS 13238-16-9 is the registry number for Dibenzylphosphine oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Dibenzyl(oxo)phosphanium (CAS 13238-16-9) is a chemical compound with the molecular formula C14H14OP+ and a molecular weight of 229.23 g/mol. IUPAC name: dibenzyl(oxo)phosphanium. InChIKey: FMUCRQUNKQURRJ-UHFFFAOYSA-N.
| Molecular formula | C14H14OP+ |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | dibenzyl(oxo)phosphanium |
| InChIKey | FMUCRQUNKQURRJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[P+](=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)