Products 13238-16-9

CAS 13238-16-9 is the registry number for Dibenzylphosphine oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Dibenzyl(oxo)phosphanium (CAS 13238-16-9) is a chemical compound with the molecular formula C14H14OP+ and a molecular weight of 229.23 g/mol. IUPAC name: dibenzyl(oxo)phosphanium. InChIKey: FMUCRQUNKQURRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14OP+
Molecular weight229.23 g/mol
IUPAC namedibenzyl(oxo)phosphanium
InChIKeyFMUCRQUNKQURRJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C[P+](=O)CC2=CC=CC=C2

Computed by PubChem (NCBI)