CAS 132388-57-9 appears in our catalog under these names: Z–Asn(Trt)–OH, Cbz-Asn(Trt)-OH 98%, (S)-2-(((Benzyloxy)carbonyl)amino)-4-oxo-4-(tritylamino)butanoic acid, 98%, 98%, N-Cbz-N'-trityl-L-asparagine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
(2S)-4-oxo-2-(phenylmethoxycarbonylamino)-4-(tritylamino)butanoic acid (CAS 132388-57-9) is a chemical compound with the molecular formula C31H28N2O5 and a molecular weight of 508.6 g/mol. IUPAC name: (2S)-4-oxo-2-(phenylmethoxycarbonylamino)-4-(tritylamino)butanoic acid. InChIKey: FPVBKISSJULIGI-MHZLTWQESA-N.
| Molecular formula | C31H28N2O5 |
|---|---|
| Molecular weight | 508.6 g/mol |
| IUPAC name | (2S)-4-oxo-2-(phenylmethoxycarbonylamino)-4-(tritylamino)butanoic acid |
| InChIKey | FPVBKISSJULIGI-MHZLTWQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC(=O)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)