CAS 132389-09-4 is the registry number for Methyl 3–hydroxy–5–(trifluoromethyl)benzo(b)thiophene–2–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Methyl 3-hydroxy-5-(trifluoromethyl)-1-benzothiophene-2-carboxylate (CAS 132389-09-4) is a chemical compound with the molecular formula C11H7F3O3S and a molecular weight of 276.23 g/mol. IUPAC name: methyl 3-hydroxy-5-(trifluoromethyl)-1-benzothiophene-2-carboxylate. InChIKey: CPPHJOZCNNWMLB-UHFFFAOYSA-N.
| Molecular formula | C11H7F3O3S |
|---|---|
| Molecular weight | 276.23 g/mol |
| IUPAC name | methyl 3-hydroxy-5-(trifluoromethyl)-1-benzothiophene-2-carboxylate |
| InChIKey | CPPHJOZCNNWMLB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=CC(=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)