CAS 132392-65-5 is the registry number for LY269415. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(methylamino)-1,3-thiazolidin-4-one (CAS 132392-65-5) is a chemical compound with the molecular formula C19H28N2O2S and a molecular weight of 348.5 g/mol. IUPAC name: (5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(methylamino)-1,3-thiazolidin-4-one. InChIKey: NKDHVZVNBMVYKJ-GDNBJRDFSA-N.
| Molecular formula | C19H28N2O2S |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | (5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(methylamino)-1,3-thiazolidin-4-one |
| InChIKey | NKDHVZVNBMVYKJ-GDNBJRDFSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C\2/C(=O)N(CS2)NC |
Computed by PubChem (NCBI)