Products 1323952-12-0
CAS 1323952-12-0 is the registry number for 1,1-Dimethylethyl 4-(5-chloro-2-pyrimidinyl)-1-piperazinecarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 4-(5-chloropyrimidin-2-yl)piperazine-1-carboxylate (CAS 1323952-12-0) is a chemical compound with the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. IUPAC name: tert-butyl 4-(5-chloropyrimidin-2-yl)piperazine-1-carboxylate. InChIKey: YLJDBQSKVVKNGY-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN4O2 |
|---|---|
| Molecular weight | 298.77 g/mol |
| IUPAC name | tert-butyl 4-(5-chloropyrimidin-2-yl)piperazine-1-carboxylate |
| InChIKey | YLJDBQSKVVKNGY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=N2)Cl |
Computed by PubChem (NCBI)