CAS 132407-66-0 is the registry number for (1-(2-Fluorophenyl)-1H-pyrrol-2-yl)methanol. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 1g, 100mg.
[1-(2-fluorophenyl)pyrrol-2-yl]methanol (CAS 132407-66-0) is a chemical compound with the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. IUPAC name: [1-(2-fluorophenyl)pyrrol-2-yl]methanol. InChIKey: SPJRIBCINFXUBI-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | [1-(2-fluorophenyl)pyrrol-2-yl]methanol |
| InChIKey | SPJRIBCINFXUBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=CC=C2CO)F |
Computed by PubChem (NCBI)