CAS 1324564-23-9 is the registry number for N-Fmoc-1-trityl L-Homohistidine. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-tritylimidazol-4-yl)butanoic acid (CAS 1324564-23-9) is a chemical compound with the molecular formula C41H35N3O4 and a molecular weight of 633.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-tritylimidazol-4-yl)butanoic acid. InChIKey: ZEKQMTMRKGEVMF-LHEWISCISA-N.
| Molecular formula | C41H35N3O4 |
|---|---|
| Molecular weight | 633.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-tritylimidazol-4-yl)butanoic acid |
| InChIKey | ZEKQMTMRKGEVMF-LHEWISCISA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=NC=C4CC[C@@H](C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57 |
Computed by PubChem (NCBI)