CAS 1324717-75-0 appears in our catalog under these names: Flupirtine-d4 HCl, Flupirtine-d4 Hydrochloride Salt, >95% (HPLC), Flupirtine–d4 (hydrochloride), Flupirtine-d4 hydrochloride, Flupirtine-d4 (hydrochloride). Offered by: Chemat Brand, TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 500μg, 1 mg.
Ethyl N-[2-amino-6-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;hydrochloride (CAS 1324717-75-0) is a chemical compound with the molecular formula C15H18ClFN4O2 and a molecular weight of 344.80 g/mol. IUPAC name: ethyl N-[2-amino-6-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;hydrochloride. InChIKey: WBAZQELGBFQHPE-HGSONKNXSA-N.
| Molecular formula | C15H18ClFN4O2 |
|---|---|
| Molecular weight | 344.80 g/mol |
| IUPAC name | ethyl N-[2-amino-6-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;hydrochloride |
| InChIKey | WBAZQELGBFQHPE-HGSONKNXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CNC2=NC(=C(C=C2)NC(=O)OCC)N)[2H])[2H])F)[2H].Cl |
Computed by PubChem (NCBI)