CAS 132472-31-2 appears in our catalog under these names: (E)-2-Amino-4-(phosphonomethyl)hept-3-enoic acid, 97%, (E)-2-Amino-4-(phosphonomethyl)hept-3-enoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(E)-2-amino-4-(phosphonomethyl)hept-3-enoic acid (CAS 132472-31-2) is a chemical compound with the molecular formula C8H16NO5P and a molecular weight of 237.19 g/mol. IUPAC name: (E)-2-amino-4-(phosphonomethyl)hept-3-enoic acid. InChIKey: ZEFQYTSQDVUMEU-GQCTYLIASA-N.
| Molecular formula | C8H16NO5P |
|---|---|
| Molecular weight | 237.19 g/mol |
| IUPAC name | (E)-2-amino-4-(phosphonomethyl)hept-3-enoic acid |
| InChIKey | ZEFQYTSQDVUMEU-GQCTYLIASA-N |
| SMILES | CCC/C(=C\C(C(=O)O)N)/CP(=O)(O)O |
Computed by PubChem (NCBI)