CAS 132483-94-4 appears in our catalog under these names: Benzaldehyde, 3-chloro-2-[(phenylmethyl)thio]-, 95%, 3–Chloro–2–((phenylmethyl)thio), 2-(Benzylthio)-3-chlorobenzaldehyde, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 25g, 5g, 1g.
2-benzylsulfanyl-3-chlorobenzaldehyde (CAS 132483-94-4) is a chemical compound with the molecular formula C14H11ClOS and a molecular weight of 262.8 g/mol. IUPAC name: 2-benzylsulfanyl-3-chlorobenzaldehyde. InChIKey: BZTUCTZFJZJNHZ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClOS |
|---|---|
| Molecular weight | 262.8 g/mol |
| IUPAC name | 2-benzylsulfanyl-3-chlorobenzaldehyde |
| InChIKey | BZTUCTZFJZJNHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=C(C=CC=C2Cl)C=O |
Computed by PubChem (NCBI)