CAS 132486-27-2 appears in our catalog under these names: (1S)-1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethan-1-ol, 95%, (1S)-1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol (CAS 132486-27-2) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol. InChIKey: QSYTYSANYGEBEZ-ZETCQYMHSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol |
| InChIKey | QSYTYSANYGEBEZ-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)OCCO2)O |
Computed by PubChem (NCBI)