CAS 1325-82-2 is the registry number for Pigment Violet 3, Strength 100%, Strength 100%. Offered by: Chemat. Available pack sizes: 100mg.
4-[(4-aminophenyl)-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline (CAS 1325-82-2) is a chemical compound with the molecular formula C20H19N3 and a molecular weight of 301.4 g/mol. IUPAC name: 4-[(4-aminophenyl)-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline. InChIKey: DWDURZSYQTXVIN-UHFFFAOYSA-N.
| Molecular formula | C20H19N3 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 4-[(4-aminophenyl)-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline |
| InChIKey | DWDURZSYQTXVIN-UHFFFAOYSA-N |
| SMILES | CN=C1C=CC(=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N)C=C1 |
Computed by PubChem (NCBI)