CAS 1325208-25-0 appears in our catalog under these names: Mal-PEG4-NHS ester, 98%, Mal-PEG4-NHS ester/ 98.31% (existing batch purity), Mal–PEG4–NHS ester, Mal-PEG4-nhsester, Mal-PEG4-NHS ester 95%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 5mg, 10mg, 25mg, 50mg, 500mg, 0,25g.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1325208-25-0) is a chemical compound with the molecular formula C19H26N2O10 and a molecular weight of 442.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: TUPOSLKVPPFQGR-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O10 |
|---|---|
| Molecular weight | 442.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | TUPOSLKVPPFQGR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)