CAS 1325210-62-5 appears in our catalog under these names: Rivaroxaban Impurity 48, Rivaroxaban Impurity 74, Rivaroxaban Impurity 31(Decarbonyl Rivaroxaban). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-chloro-N-[(2S)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]thiophene-2-carboxamide (CAS 1325210-62-5) is a chemical compound with the molecular formula C18H20ClN3O4S and a molecular weight of 409.9 g/mol. IUPAC name: 5-chloro-N-[(2S)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]thiophene-2-carboxamide. InChIKey: OKMRQXXUAFSBCM-AWEZNQCLSA-N.
| Molecular formula | C18H20ClN3O4S |
|---|---|
| Molecular weight | 409.9 g/mol |
| IUPAC name | 5-chloro-N-[(2S)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]thiophene-2-carboxamide |
| InChIKey | OKMRQXXUAFSBCM-AWEZNQCLSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)NC[C@@H](CNC(=O)C3=CC=C(S3)Cl)O |
Computed by PubChem (NCBI)