CAS 132530-67-7 appears in our catalog under these names: 1,3–Dibromo–4,6–Bis(Acetamido)Benzene, N,N'-(4,6-Dibromo-1,3-phenylene)diacetamide 97%, 1,1'-(Butane-1,4-diyl)bis(3-(2-(2-(2-aminoethoxy)ethoxy)ethyl)urea) 2hcl, 97%, 97%, 1,3-DIBROMO-4,6-BIS(ACETAMIDO)BENZENE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
N-(5-acetamido-2,4-dibromophenyl)acetamide (CAS 132530-67-7) is a chemical compound with the molecular formula C10H10Br2N2O2 and a molecular weight of 350.01 g/mol. IUPAC name: N-(5-acetamido-2,4-dibromophenyl)acetamide. InChIKey: ZESMJYDAJIBPHA-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2N2O2 |
|---|---|
| Molecular weight | 350.01 g/mol |
| IUPAC name | N-(5-acetamido-2,4-dibromophenyl)acetamide |
| InChIKey | ZESMJYDAJIBPHA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Br)Br)NC(=O)C |
Computed by PubChem (NCBI)