CAS 1325334-71-1 is the registry number for 1-Benzyl-3-(3,4-difluorophenyl)urea, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 250mg, 5g, 1g.
1-benzyl-3-(3,4-difluorophenyl)urea (CAS 1325334-71-1) is a chemical compound with the molecular formula C14H12F2N2O and a molecular weight of 262.25 g/mol. IUPAC name: 1-benzyl-3-(3,4-difluorophenyl)urea. InChIKey: CZQPYOUKMNARTK-UHFFFAOYSA-N.
| Molecular formula | C14H12F2N2O |
|---|---|
| Molecular weight | 262.25 g/mol |
| IUPAC name | 1-benzyl-3-(3,4-difluorophenyl)urea |
| InChIKey | CZQPYOUKMNARTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)NC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)