CAS 132541-52-7 appears in our catalog under these names: (Hydroxy(naphthalen-2-yl)methyl)phosphonic acid, 97%, Hydroxy(2-naphthyl)methanephosphonic Acid, HNMPA/ 99.11% (existing batch purity), HNMPA, (Hydroxy-2-naphthylmethyl)phosphonic acid, 98% . Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg, 25mg, 50mg, 100mg.
[hydroxy(naphthalen-2-yl)methyl]phosphonic acid (CAS 132541-52-7) is a chemical compound with the molecular formula C11H11O4P and a molecular weight of 238.18 g/mol. IUPAC name: [hydroxy(naphthalen-2-yl)methyl]phosphonic acid. InChIKey: AMJJLDJPDLKNJA-UHFFFAOYSA-N.
| Molecular formula | C11H11O4P |
|---|---|
| Molecular weight | 238.18 g/mol |
| IUPAC name | [hydroxy(naphthalen-2-yl)methyl]phosphonic acid |
| InChIKey | AMJJLDJPDLKNJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(O)P(=O)(O)O |
Computed by PubChem (NCBI)