CAS 132548-09-5 appears in our catalog under these names: H–Leu–Ala–Pro–OH, H-Leu-Ala-Pro-OH. Offered by: GLPBio, Creative Peptides, Biosynth. Available pack sizes: 5g, on request, 1g, 1000mg, 2000mg, 5000mg.
(2S)-1-[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (CAS 132548-09-5) is a chemical compound with the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. IUPAC name: (2S)-1-[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: WSGXUIQTEZDVHJ-DCAQKATOSA-N.
| Molecular formula | C14H25N3O4 |
|---|---|
| Molecular weight | 299.37 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WSGXUIQTEZDVHJ-DCAQKATOSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CC(C)C)N |
Computed by PubChem (NCBI)