CAS 1325559-21-4 is the registry number for Diallyl-d10-amine. Offered by: TRC. Available pack sizes: 25mg.
1,1,2,3,3-pentadeuterio-N-(1,1,2,3,3-pentadeuterioprop-2-enyl)prop-2-en-1-amine (CAS 1325559-21-4) is a chemical compound with the molecular formula C6H11N and a molecular weight of 107.22 g/mol. IUPAC name: 1,1,2,3,3-pentadeuterio-N-(1,1,2,3,3-pentadeuterioprop-2-enyl)prop-2-en-1-amine. InChIKey: DYUWTXWIYMHBQS-URTNXKOFSA-N.
| Molecular formula | C6H11N |
|---|---|
| Molecular weight | 107.22 g/mol |
| IUPAC name | 1,1,2,3,3-pentadeuterio-N-(1,1,2,3,3-pentadeuterioprop-2-enyl)prop-2-en-1-amine |
| InChIKey | DYUWTXWIYMHBQS-URTNXKOFSA-N |
| SMILES | [2H]C(=C([2H])C([2H])([2H])NC([2H])([2H])C(=C([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)