CAS 1325559-31-6 appears in our catalog under these names: Nitroxynil-13C6, Nitroxinil-13C6, 13C6-Nitroxinil, Concentration: 100 µg/ml Solvent: Methanol, 13C6-Nitroxinil. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 10mg, 1mg, 5mg, 1x1ml, 1x10mg.
4-hydroxy-5-iodo-3-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile (CAS 1325559-31-6) is a chemical compound with the molecular formula C7H3IN2O3 and a molecular weight of 295.97 g/mol. IUPAC name: 4-hydroxy-5-iodo-3-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile. InChIKey: SGKGVABHDAQAJO-ZRDHQLPYSA-N.
| Molecular formula | C7H3IN2O3 |
|---|---|
| Molecular weight | 295.97 g/mol |
| IUPAC name | 4-hydroxy-5-iodo-3-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile |
| InChIKey | SGKGVABHDAQAJO-ZRDHQLPYSA-N |
| SMILES | [13CH]1=[13C]([13CH]=[13C]([13C](=[13C]1[N+](=O)[O-])O)I)C#N |
Computed by PubChem (NCBI)