CAS 13257-51-7 appears in our catalog under these names: Mercuric Trifluoroacetate, Mercury(II) trifluoroacetate, 98+% . Offered by: TRC, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100mg, 1g, 500mg, 5g, 25g, 10g, 50g.
Mercury(2+);bis(2,2,2-trifluoroacetate) (CAS 13257-51-7) is a chemical compound with the molecular formula C4F6HgO4 and a molecular weight of 426.62 g/mol. IUPAC name: mercury(2+);bis(2,2,2-trifluoroacetate). InChIKey: WMHOESUUCMEQMS-UHFFFAOYSA-L.
| Molecular formula | C4F6HgO4 |
|---|---|
| Molecular weight | 426.62 g/mol |
| IUPAC name | mercury(2+);bis(2,2,2-trifluoroacetate) |
| InChIKey | WMHOESUUCMEQMS-UHFFFAOYSA-L |
| SMILES | C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Hg+2] |
Computed by PubChem (NCBI)