CAS 13257-81-3 appears in our catalog under these names: 4–Trimethylsilyloxy–3–penten–2–one, 4-Trimethylsilyloxy-3-penten-2-one, 95%, 4-(Trimethylsiloxy)-3-penten-2-one 95%. Offered by: GLPBio, Combi-blocks, Ambeed. Available pack sizes: 1ml, 5ml, 1g, 25g, 5g.
(E)-4-trimethylsilyloxypent-3-en-2-one (CAS 13257-81-3) is a chemical compound with the molecular formula C8H16O2Si and a molecular weight of 172.30 g/mol. IUPAC name: (E)-4-trimethylsilyloxypent-3-en-2-one. InChIKey: FBADCSUQBLLAHW-SOFGYWHQSA-N.
| Molecular formula | C8H16O2Si |
|---|---|
| Molecular weight | 172.30 g/mol |
| IUPAC name | (E)-4-trimethylsilyloxypent-3-en-2-one |
| InChIKey | FBADCSUQBLLAHW-SOFGYWHQSA-N |
| SMILES | C/C(=C\C(=O)C)/O[Si](C)(C)C |
Computed by PubChem (NCBI)