CAS 132570-56-0 appears in our catalog under these names: (2,2-dimethyl-2,3-dihydro-1-benzofuran-5-yl)methanamine, (2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-yl)methanamine, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg.
(2,2-dimethyl-3H-1-benzofuran-5-yl)methanamine (CAS 132570-56-0) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: (2,2-dimethyl-3H-1-benzofuran-5-yl)methanamine. InChIKey: TVVYGQVELAATAQ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | (2,2-dimethyl-3H-1-benzofuran-5-yl)methanamine |
| InChIKey | TVVYGQVELAATAQ-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C=CC(=C2)CN)C |
Computed by PubChem (NCBI)